| Customization: | Available |
|---|---|
| CAS No.: | 18547-93-8 |
| Formula: | C18H34O5Si2 |
|
Still deciding? Get samples of $ !
Request Sample
|
Suppliers with verified business licenses
Audited by an independent third-party inspection agency
| Chemical Properties | ||
| Melting point | <0°C | |
| Boiling point | 127°C 3mm | |
| density | 0.966 g/mL at 20 °C(lit.) | |
| vapor pressure | 0.005Pa at 25ºC | |
| refractive index | n20/D 1.45 | |
| Fp | >110°C | |
| storage temp. | below 5° C | |
| Specific Gravity | 0.96 | |
| Water Solubility | 1.5μg/L at 20ºC | |
| Hydrolytic Sensitivity | 3: reacts with aqueous base | |
| InChI | InChI=1S/C18H34O5Si2/c1-15(2)17(19)21-11-9-13-24(5,6)23-25(7,8)14-10-12-22-18(20)16(3)4/h1,3,9-14H2,2,4-8H3 | |
| InChIKey | ZIFLDVXQTMSDJE-UHFFFAOYSA-N | |
| SMILES | [Si](CCCOC(=O)C(C)=C)(C)(C)O[Si](CCCOC(=O)C(C)=C)(C)C | |
| LogP | 8.1 at 20ºC | |
| Safety Data | ||
| Hazard Codes | Xi | |
| Risk Statements | R36/37/38:Irritating to eyes, respiratory system and skin . | |
| Safety Statements | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice . S36:Wear suitable protective clothing . |
|
| WGK Germany | 3 |
|
| TSCA | Yes |
|





Contact Us